Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 99-61-6, Name is 3-Nitrobenzaldehyde, SMILES is O=CC1=CC=CC([N+]([O-])=O)=C1, belongs to thiomorpholine compound. In a document, author is Renaud, T, introduce the new discover, Recommanded Product: 3-Nitrobenzaldehyde.
Synthesis of new quinoxaline derivatives by reductive cyclization of various 1-(2-nitrophenyl)-2-cyanoamines
The electrochemical cyanation of various six-membered N-(2-nitrophenyl) heterocyclic amines, including piperidine, morpholine, thiomorpholine, and N-Boc-protected piperazine derivatives, was investigated. The expected cyanoamines 5 were obtained in good yields and subjected to catalytic hydrogenation to afford the corresponding cyclic amidine N-oxides 6. The reductive cyclization proceeded through the formation of a hydroxylamine, which cyclized onto the cyano moiety. The stereoselectivity of the cyclization reaction was studied for the cases both of trans-5f, in which the substituent was axial and the 4-methyl substituent equatorial, and of cis-5f, in which both the 2-cyano and the substituents were equatorial. The expected tetrahydroquinoxalines 3 were conveniently prepared in a following step by the catalytic hydrogenation of cyclic amidines 6 in the presence of Pearlman’s catalyst at five atmospheres of hydrogen pressure.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 99-61-6 is helpful to your research. Recommanded Product: 3-Nitrobenzaldehyde.
Reference:
Thiomorpholine – Wikipedia,
,Thiomorpholine | C4H9NS – PubChem