Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 119-47-1, Name is 2,2-Methylenebis(6-tert-butyl-p-cresol), SMILES is OC1=C(CC2=C(O)C(C(C)(C)C)=CC(C)=C2)C=C(C)C=C1C(C)(C)C, belongs to thiomorpholine compound. In a document, author is Babic-Samardija, K., introduce the new discover, Recommanded Product: 119-47-1.
Molecular structure in correlation with electrochemical properties of mixed-ligand cobalt(III) complexes
Four mixed-ligand cobalt(III) complexes (1-4) of the general formula [Co(Rdtc)cyclam](ClO4)(2) and [Co(Rac)cyclam](ClO4)(2) (cyclam = 1,4,8,11-tetraazacyclotetradecane; Rdtc = thiomorpholine-(Timdtc) or 2-methylpiperidine-(2-Mepipdtc) dithiocarbamates; Rac = 1,1,1,5,5,5-hexafluoro-2,4-pentanedionato (Hfac) or 2,2,6,6-tetramethyl-3,5-heptanedionato (Tmhd), respectively) were electrochemically examined on a glassy carbon and an iron electrode in perchloric acid solution. The obtained results showed the influence of these complexes on hydrogen evolution, the oxygen reduction reaction and iron dissolution. The exhibited effects of the complexes on these reactions depend on structure related to the bidentate dithiocarbamato or beta-diketonato ligand. The electrochemical properties of the complexes were correlated with molecular structure and parameters derived from spectral analysis and molecular modeling.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 119-47-1 is helpful to your research. Recommanded Product: 119-47-1.
Reference:
Thiomorpholine – Wikipedia,
,Thiomorpholine | C4H9NS – PubChem